137529-57-8 Usage
General Description
1,2,3-Trifluoro-5-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is a chemical compound with a complex molecular structure. It consists of a benzene ring with three fluorine atoms attached at positions 1, 2, and 3, and a cyclohexyl group substituted at positions 4 and 5. Additionally, there are two ethylcyclohexyl groups attached to the benzene ring, giving the molecule a bulky and complex three-dimensional structure. 1,2,3-Trifluoro-5-(4-(2-(4-ethylcyclohexyl)ethyl)cyclohexyl)benzene is likely to have unique physical and chemical properties due to its specific molecular arrangement, and it may have potential applications in various fields such as organic synthesis, pharmaceuticals, and materials science. However, due to the complexity of its structure and the presence of fluorine and benzene moieties, it may also pose potential health and environmental risks that require further investigation and careful handling.
Check Digit Verification of cas no
The CAS Registry Mumber 137529-57-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,7,5,2 and 9 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 137529-57:
(8*1)+(7*3)+(6*7)+(5*5)+(4*2)+(3*9)+(2*5)+(1*7)=148
148 % 10 = 8
So 137529-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C22H31F3/c1-2-15-3-5-16(6-4-15)7-8-17-9-11-18(12-10-17)19-13-20(23)22(25)21(24)14-19/h13-18H,2-12H2,1H3
137529-57-8Relevant articles and documents
Trifluorinated liquid crystals for TFT displays
Demus,Goto,Sawada,Nakagawa,Saito
, p. 1 - 21 (2007/10/02)
3, 4, 5-tri-fluorobenzene derivatives with different core structures have been synthesized and their physical properties have been determined. Most of the compounds are nematic with broad existence regions. The materials have large dielectric anisotropy, low viscosity, low optical anisotropy and very good voltage holding ratio and high chemical stability and are valuable components for mixtures to be used in TFT displays. The good voltage holding ratio of the compounds is related to their high electrical resistivity. In order to reproduce the dependence of the resistivity on the dielectric constant, we derived a general formula. Its derivation is based on the interaction of the impurity ions with the induced and permanent dipoles of the liquid crystal molecules. We are able to show, that ion/ion interactions in highly purified liquid crystals may be neglected.