13788-32-4 Usage
Description
1-(2-Furylmethyl)-1H-pyrrole-2-carbaldehyde is an organic compound belonging to the furfuryl-pyrroles class. It is characterized by its distinct organoleptic properties, which contribute to the unique flavors and aromas in a variety of foods.
Uses
Used in Flavor and Fragrance Industry:
1-(2-Furylmethyl)-1H-pyrrole-2-carbaldehyde is used as a flavoring agent for its ability to impart desirable taste and aroma to various food products. Its organoleptic properties are detected in a range of foods, including coffee, chocolate, popcorn, and roasted chicken, enhancing their overall sensory experience.
Used in Food Industry:
In the food industry, 1-(2-Furylmethyl)-1H-pyrrole-2-carbaldehyde is utilized as an additive to create or enhance specific flavors in different culinary applications. Its unique properties allow it to contribute to the taste and aroma profiles of products, making it a valuable component in the development of new and improved food items.
Check Digit Verification of cas no
The CAS Registry Mumber 13788-32-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,7,8 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13788-32:
(7*1)+(6*3)+(5*7)+(4*8)+(3*8)+(2*3)+(1*2)=124
124 % 10 = 4
So 13788-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO2/c12-8-9-3-1-5-11(9)7-10-4-2-6-13-10/h1-6,8H,7H2
