138716-53-7 Usage
General Description
2-[(DIMETHYLAMINO)METHYLENE]-3-(4-BIPHENYLYL)-3-OXO-PROPANENITRILE is a chemical compound with a complex structure and multiple functional groups. It contains a dimethylamino group, a methylene group, and a propanenitrile group, as well as a biphenyl group. The compound is an oxo derivative, meaning it contains a carbon double-bonded to an oxygen atom. The presence of these different groups gives the compound a wide range of potential applications in various chemical reactions and processes.
Check Digit Verification of cas no
The CAS Registry Mumber 138716-53-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,7,1 and 6 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 138716-53:
(8*1)+(7*3)+(6*8)+(5*7)+(4*1)+(3*6)+(2*5)+(1*3)=147
147 % 10 = 7
So 138716-53-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H16N2O/c1-20(2)13-17(12-19)18(21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11,13H,1-2H3/b17-13+
