138800-17-6 Usage
General Description
2,8,9-Trimethyl-2,5,8,9-tetraaza-1-phospha-cyclopentan-1-ylium is a chemical compound with the molecular formula C8H24N4P. It is a cationic compound containing a phosphorus atom and four nitrogen atoms, as well as three methyl groups. 2 8 9-TRIMETHYL-2 5 8 9-TETRAAZA-1-PHOS& is often used as a ligand in coordination chemistry due to its ability to bind to metal ions and form stable complexes. It has been studied for its potential applications in catalysis and as a chelating agent in various chemical reactions. Additionally, its structure and properties have been investigated for potential use in medicinal and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 138800-17-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,8,8,0 and 0 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 138800-17:
(8*1)+(7*3)+(6*8)+(5*8)+(4*0)+(3*0)+(2*1)+(1*7)=126
126 % 10 = 6
So 138800-17-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H21N4P.ClH/c1-10-4-7-13-8-5-11(2)14(10)12(3)6-9-13;/h4-9H2,1-3H3;1H