13988-32-4 Usage
General Description
1-(p-ethoxyphenyl)-N,N-diethyl-3-phenylbutylamine is a chemical compound that belongs to the class of arylalkylamines. It is a psychoactive drug with stimulant properties, and it is commonly used as a recreational drug due to its effects on mood and cognitive function. The compound is known to affect the central nervous system by increasing the levels of certain neurotransmitters such as dopamine and norepinephrine, leading to feelings of euphoria, increased focus, and alertness. The chemical structure of 1-(p-ethoxyphenyl)-N,N-diethyl-3-phenylbutylamine includes an ethoxyphenyl group, a diethylamino group, and a phenylbutylamine group, which are responsible for its pharmacological effects. However, the compound is also associated with potential side effects and health risks, including addiction, cardiovascular problems, and neurotoxicity. Due to these concerns, the use and distribution of 1-(p-ethoxyphenyl)-N,N-diethyl-3-phenylbutylamine are heavily regulated in many countries.
Check Digit Verification of cas no
The CAS Registry Mumber 13988-32-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,9,8 and 8 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13988-32:
(7*1)+(6*3)+(5*9)+(4*8)+(3*8)+(2*3)+(1*2)=134
134 % 10 = 4
So 13988-32-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H31NO/c1-5-23(6-2)22(17-18(4)19-11-9-8-10-12-19)20-13-15-21(16-14-20)24-7-3/h8-16,18,22H,5-7,17H2,1-4H3