140245-76-7 Usage
Property
Different sources of media describe the Property of 140245-76-7 differently. You can refer to the following data:
1. Long-chain polyunsaturated fatty acid
2. Belongs to the group of omega-6 fatty acids
3. Found in various animal tissues, particularly in the brain and liver
4. Present in certain plant sources such as soybean and sunflower
5. Believed to have anti-inflammatory properties
6. May play a role in prevention of chronic diseases such as cardiovascular disease and arthritis
7. Involved in cell membrane structure and function
8. May have a role in gene regulation and signaling pathways within the body
9. Further research is needed to fully understand the effects on human health.
Check Digit Verification of cas no
The CAS Registry Mumber 140245-76-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,0,2,4 and 5 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 140245-76:
(8*1)+(7*4)+(6*0)+(5*2)+(4*4)+(3*5)+(2*7)+(1*6)=97
97 % 10 = 7
So 140245-76-7 is a valid CAS Registry Number.
InChI:InChI=1/C25H46O2/c1-24(2)22-20-18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21-23-25(26)27/h7,9,15,17,24H,3-6,8,10-14,16,18-23H2,1-2H3,(H,26,27)/b9-7-,17-15-