14058-38-9 Usage
Description
6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol is an alkaloid derived from the leaves of Prosopis africana Taub. It is closely related to two other alkaloids and forms colorless crystals when dissolved in Me2CO. The compound has a specific optical rotation of [el:]D + 25° (CHC13) and is characterized by its unique structure, which includes a 3-hydroxy, 6-(11-hydroxydedecyl), and 2-hydroxymethylpiperidine moiety.
Uses
Used in Pharmaceutical Industry:
6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol is used as a pharmaceutical compound for its potential therapeutic applications. The compound's unique structure and properties make it a promising candidate for the development of new drugs, particularly in the treatment of various diseases and conditions.
Used in Chemical Research:
In the field of chemical research, 6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol serves as a valuable compound for studying its chemical properties, reactivity, and potential interactions with other molecules. This research can lead to a better understanding of the compound's behavior and its potential applications in various industries.
Used in Drug Delivery Systems:
Similar to gallotannin, 6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol can be employed in the development of novel drug delivery systems. These systems can enhance the compound's delivery, bioavailability, and therapeutic outcomes, making it more effective in treating specific conditions or diseases.
Used in Cosmetics Industry:
Due to its unique structure and properties, 6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol may also find applications in the cosmetics industry. It could be used as an active ingredient in various cosmetic products, such as creams, lotions, or serums, to provide specific benefits to the skin, hair, or nails.
Used in Agrochemical Industry:
The compound's potential applications in the agrochemical industry could include its use as a component in the development of new pesticides, herbicides, or other agricultural chemicals. Its unique properties may contribute to the effectiveness of these products in protecting crops and enhancing agricultural productivity.
Used in Material Science:
6-(11-hydroxydodecyl)-2-(hydroxymethyl)piperidin-3-ol may also have potential applications in material science, where its unique structure and properties could be utilized in the development of new materials with specific characteristics, such as improved strength, durability, or functionality.
References
Khuong-Huu et ai., Bull. Soc. Chim. Belg., 81,425 (972)
Check Digit Verification of cas no
The CAS Registry Mumber 14058-38-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,0,5 and 8 respectively; the second part has 2 digits, 3 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 14058-38:
(7*1)+(6*4)+(5*0)+(4*5)+(3*8)+(2*3)+(1*8)=89
89 % 10 = 9
So 14058-38-9 is a valid CAS Registry Number.
InChI:InChI=1/C18H37NO3/c1-15(21)10-8-6-4-2-3-5-7-9-11-16-12-13-18(22)17(14-20)19-16/h15-22H,2-14H2,1H3
14058-38-9Relevant articles and documents
A configurational switch based on iridium-catalyzed allylic cyclization: Application in asymmetric total syntheses of prosopis, dendrobate, and spruce alkaloids
Gnamm, Christian,Broedner, Kerstin,Krauter, Caroline M.,Helmchen, Guenter
experimental part, p. 10514 - 10532 (2010/04/29)
A method for the stereoselective synthesis of 2,6-disubstituted piperidines has been developed that is based on the use of an intramolecular iridium-catalyzed allylic substitution as a configurational switch. The procedure allows the preparation of 2-viny
