142013-66-9 Usage
General Description
4-Piperazine-piperidine is a chemical compound that combines the structures of 4-piperidinol and piperazine. It is a heterocyclic organic compound with potential use as a pharmaceutical intermediate for the synthesis of various drugs. It is commonly used in the production of medications for various therapeutic areas such as anti-inflammatory, anti-bacterial, and anti-viral drugs. Additionally, it is also used as an intermediate for the synthesis of pesticides and other agrochemicals. 4-Piperazine-piperidine has shown promising pharmacological properties, including potential use as an analgesic and anti-cancer agent. However, further research and development are needed to fully understand and exploit its therapeutic potential.
Check Digit Verification of cas no
The CAS Registry Mumber 142013-66-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,0,1 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 142013-66:
(8*1)+(7*4)+(6*2)+(5*0)+(4*1)+(3*3)+(2*6)+(1*6)=79
79 % 10 = 9
So 142013-66-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H19N3/c1-3-10-4-2-9(1)12-7-5-11-6-8-12/h9-11H,1-8H2
