142508-08-5 Usage
General Description
The chemical (1R,2S)-2-(cyclohexylamino)-1,2-diphenylethanol is a chiral compound with a structure that contains a cyclohexylamine group and two phenyl groups attached to a chiral carbon. (1R,2S)-2-(CYCLOHEXYLAMINO)-1,2-DIPHENYLETHANOL is commonly used in pharmaceutical and medicinal chemistry as a building block for the synthesis of various drug molecules. It has also been studied for its potential pharmacological activities, including as a potential analgesic and anti-inflammatory agent. Additionally, its stereochemistry and molecular structure make it a useful tool for studying the interactions of chiral molecules in biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 142508-08-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,5,0 and 8 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 142508-08:
(8*1)+(7*4)+(6*2)+(5*5)+(4*0)+(3*8)+(2*0)+(1*8)=105
105 % 10 = 5
So 142508-08-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H25NO/c22-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)21-18-14-8-3-9-15-18/h1-2,4-7,10-13,18-22H,3,8-9,14-15H2/t19-,20+/m0/s1