142784-25-6 Usage
Description
N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine, also known as C8-dG adduct, is a DNA adduct formed from N-Hydroxy-PHIP. It is a pale yellow solid that plays a significant role in the field of cancer research due to its mutagenic properties and its ability to hinder translocation in DNA polymerase.
Uses
Used in Cancer Research:
N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine is used as a research tool for studying the mechanisms of mutagenesis and DNA repair. Its formation as a DNA adduct from N-Hydroxy-PHIP contributes to the understanding of how certain food carcinogens can lead to genetic mutations and potentially cancerous cell growth.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine is used as a compound of interest for the development of potential cancer therapeutics. Its interaction with DNA polymerase and its mutagenic properties make it a valuable target for designing drugs that can counteract the harmful effects of food carcinogens and protect against cancer development.
Used in Analytical Chemistry:
N-(deoxyguanosin-8-yl)-2-amino-1-methyl-6-phenylimidazo(4,5-b)pyridine is also used in analytical chemistry for the detection and quantification of DNA adducts formed by food carcinogens. This helps in assessing the risk of cancer associated with the consumption of certain foods and contributes to the development of safety standards and guidelines in the food industry.
Check Digit Verification of cas no
The CAS Registry Mumber 142784-25-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,2,7,8 and 4 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 142784-25:
(8*1)+(7*4)+(6*2)+(5*7)+(4*8)+(3*4)+(2*2)+(1*5)=136
136 % 10 = 6
So 142784-25-6 is a valid CAS Registry Number.
InChI:InChI=1/C23H23N9O4/c1-31-13-7-12(11-5-3-2-4-6-11)9-25-18(13)27-22(31)30-23-26-17-19(28-21(24)29-20(17)35)32(23)16-8-14(34)15(10-33)36-16/h2-7,9,14-16,33-34H,8,10H2,1H3,(H3,24,28,29,35)(H,25,26,27,30)/t14-,15+,16+/m0/s1