145739-56-6 Usage
General Description
6-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]pyridine-2-carboxylic acid is a chemical compound with a complex structure. It contains a pyridine ring, a thiazolyl ring, and a carboxylic acid group. The compound also has two diethoxyphenyl groups attached to the thiazolyl ring. This chemical is likely to have potential applications in pharmaceutical research and drug development due to its unique structure and potential biological activity. It may be used in the development of new drugs for the treatment of various diseases and conditions. Additionally, it may also have uses in the field of organic chemistry for the synthesis of more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 145739-56-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,7,3 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 145739-56:
(8*1)+(7*4)+(6*5)+(5*7)+(4*3)+(3*9)+(2*5)+(1*6)=156
156 % 10 = 6
So 145739-56-6 is a valid CAS Registry Number.
InChI:InChI=1/C19H18N2O4S/c1-3-24-16-9-8-12(10-17(16)25-4-2)18-21-15(11-26-18)13-6-5-7-14(20-13)19(22)23/h5-11H,3-4H2,1-2H3,(H,22,23)
145739-56-6Relevant articles and documents
TETOMILAST POLYMORPHS
-
Page/Page column 53-55, (2008/06/13)
The present invention provides a tetomilast crystal that is industrially easily produced in a large volume. (1) a tetomilast hydrate crystal having a powder X-ray diffraction spectrum that is substantially the same as the powder X-ray diffraction spectrum