14608-27-6 Usage
Chemical structure
A complex structure with two separate amino groups attached to an anthraquinone backbone and a 7-oxo-7H-benz[de]anthracen-3-yl group.
Amino groups
Two amino groups are present in the compound, which can participate in various chemical reactions and contribute to its reactivity.
Anthraquinone backbone
The central structure of the compound, which provides stability and contributes to its potential applications.
7-oxo-7H-benz[de]anthracen-3-yl group
A seven-membered ring structure with a ketone group, which adds complexity to the molecule and may influence its properties.
Member of anthraquinone family
The compound belongs to the anthraquinone family, which is known for its diverse applications in organic synthesis, pharmaceuticals, and dyes.
Potential uses
Due to its complex structure and functional groups, the compound may have potential applications in various industrial and scientific fields, such as organic synthesis, pharmaceuticals, and as a dye.
Versatility
The intricate structure and functional groups of the compound make it a potentially versatile molecule for different applications.
Chemical reactivity
The presence of amino groups and the 7-oxo-7H-benz[de]anthracen-3-yl group may contribute to the compound's reactivity in various chemical reactions.
Stability
The anthraquinone backbone provides stability to the molecule, which may be important for its potential applications.
Research and development
Further research and development may be necessary to fully understand the properties and potential applications of this complex chemical compound.
Check Digit Verification of cas no
The CAS Registry Mumber 14608-27-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,4,6,0 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 14608-27:
(7*1)+(6*4)+(5*6)+(4*0)+(3*8)+(2*2)+(1*7)=96
96 % 10 = 6
So 14608-27-6 is a valid CAS Registry Number.
InChI:InChI=1/C31H18N2O3/c32-23-12-4-10-21-27(23)30(35)22-11-5-13-25(28(22)31(21)36)33-24-15-14-17-16-6-1-2-7-18(16)29(34)20-9-3-8-19(24)26(17)20/h1-15,33H,32H2