147190-31-6 Usage
Description
2-(N-Fmoc-4-aminobutyl)-1,3-propanediol is a white solid that serves as a synthetic intermediate in the field of chemistry. It is particularly useful for the synthesis of oligonucleotides, where it acts as a C7 type linker. 2-(N-Fmoc-4-aminobutyl)-1,3-propanediol is valuable in the development of various pharmaceutical and biotechnological applications due to its unique chemical properties and ability to facilitate the formation of complex molecular structures.
Uses
Used in Pharmaceutical and Biotechnology Industry:
2-(N-Fmoc-4-aminobutyl)-1,3-propanediol is used as a synthetic intermediate for the development of oligonucleotides, which are essential in various pharmaceutical and biotechnological applications. Its role as a C7 type linker allows for the efficient and precise synthesis of these complex molecules, contributing to the advancement of drug discovery and gene therapy.
Used in Oligonucleotide Synthesis:
2-(N-Fmoc-4-aminobutyl)-1,3-propanediol is used as a synthetic intermediate for oligonucleotide synthesis. Its unique structure enables the formation of stable and functional oligonucleotides, which are crucial in the development of new drugs and therapies. 2-(N-Fmoc-4-aminobutyl)-1,3-propanediol plays a vital role in the creation of molecules that can target specific genetic sequences, potentially leading to more effective treatments for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 147190-31-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,1,9 and 0 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 147190-31:
(8*1)+(7*4)+(6*7)+(5*1)+(4*9)+(3*0)+(2*3)+(1*1)=126
126 % 10 = 6
So 147190-31-6 is a valid CAS Registry Number.
InChI:InChI=1/C22H27NO4/c24-13-16(14-25)7-5-6-12-23-22(26)27-15-21-19-10-3-1-8-17(19)18-9-2-4-11-20(18)21/h1-4,8-11,16,21,24-25H,5-7,12-15H2,(H,23,26)