147597-66-8 Usage
Description
2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is a versatile chemical compound with potential applications in bioconjugation and molecular imaging. It features a benzyl group connected to a triazacyclononane core, which can form stable complexes with various metal ions such as copper, gallium, and indium. The isothiocyanate functional group in the compound enables covalent attachment to biomolecules, making it a promising candidate for the development of new radiopharmaceuticals and targeted imaging probes.
Uses
Used in Biomedical Applications:
2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is used as a complexing agent for metal ions in the development of new radiopharmaceuticals. Its ability to form stable complexes with copper, gallium, and indium makes it a promising candidate for cancer diagnosis and treatment.
Used in Molecular Imaging:
2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is used as a molecular imaging agent for positron emission tomography (PET) imaging. The stable metal complexes formed by this compound have been explored for their potential in PET imaging, which could lead to advancements in cancer diagnosis.
Used in Bioconjugation:
2-(4-isothiocyanatobenzyl)-1,4,7-triazacyclononane-1,4,7-triacetic acid is used as a bioconjugation agent for the covalent attachment to biomolecules. The isothiocyanate functional group allows for the development of targeted imaging probes and therapeutics, enhancing the specificity and effectiveness of these applications in the biomedical field.
Check Digit Verification of cas no
The CAS Registry Mumber 147597-66-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,7,5,9 and 7 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 147597-66:
(8*1)+(7*4)+(6*7)+(5*5)+(4*9)+(3*7)+(2*6)+(1*6)=178
178 % 10 = 8
So 147597-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C20H24N4O6S/c25-18(26)11-22-5-6-23(12-19(27)28)10-17(24(8-7-22)13-20(29)30)9-15-1-3-16(4-2-15)21-14-31/h1-4,7-8,17H,5-6,9-13H2,(H,25,26)(H,27,28)(H,29,30)/b8-7-