15087-06-6 Usage
General Description
1,3,5[10]-ESTRATRIENE-3,16ALPHA,17BETA-TRIOL 3-GLUCURONIDE SODIUM SALT is a chemical compound that is a sodium salt form of a glucuronide conjugate of 1,3,5[10]-estratriene-3,16alpha,17beta-triol. It is a steroid hormone derivative that plays a role in the regulation of various physiological processes in the body. 1,3,5[10]-ESTRATRIENE-3,16ALPHA,17BETA-TRIOL 3-GLUCURONIDE SODIUM SALT is often used in pharmaceutical research and drug development as it can potentially be used for the treatment of hormone-related conditions or as a biomarker for certain diseases. Its sodium salt form enhances its solubility in aqueous solutions, making it more suitable for various pharmaceutical and biological applications.
Check Digit Verification of cas no
The CAS Registry Mumber 15087-06-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,0,8 and 7 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 15087-06:
(7*1)+(6*5)+(5*0)+(4*8)+(3*7)+(2*0)+(1*6)=96
96 % 10 = 6
So 15087-06-6 is a valid CAS Registry Number.
InChI:InChI=1/C24H32O9.Na/c1-24-7-6-13-12-5-3-11(32-23-19(28)17(26)18(27)20(33-23)22(30)31)8-10(12)2-4-14(13)15(24)9-16(25)21(24)29;/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31);