156276-40-3 Usage
General Description
"2-((3-(hydroxymethyl)oxetan-3-yl)methyl)isoindoline-1,3-dione" is a chemical compound that contains a complex structure with multiple functional groups. It consists of an isoindoline-1,3-dione core with a side chain containing a hydroxymethyl group and an oxetanyl group. 2-((3-(hydroxymethyl)oxetan-3-yl)methyl)isoindoline-1,3-dione is likely to exhibit diverse chemical properties due to the presence of the oxetanyl group, which can undergo ring-opening reactions, and the isoindoline-1,3-dione core, which is known for its potential biological and pharmacological activities. Further studies would be required to understand the precise characteristics and potential applications of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 156276-40-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,6,2,7 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 156276-40:
(8*1)+(7*5)+(6*6)+(5*2)+(4*7)+(3*6)+(2*4)+(1*0)=143
143 % 10 = 3
So 156276-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO4/c15-6-13(7-18-8-13)5-14-11(16)9-3-1-2-4-10(9)12(14)17/h1-4,15H,5-8H2
