1563-84-4 Usage
Description
N-acetyl-N-propylacetamide is a chemical compound that belongs to the class of amides. It is a white crystalline solid with a molecular formula of C7H13NO2 and a molecular weight of 143.184 g/mol. N-acetyl-N-propylacetamide is known for its anti-inflammatory and analgesic properties, making it a valuable ingredient in pharmaceutical and cosmetic products. Additionally, it serves as a solvent in the production of various organic compounds. Synthesized through the reaction of acetic anhydride with propylamine, N-acetyl-N-propylacetamide is considered relatively stable under normal conditions. However, due to limited information on its specific health effects, it is crucial to handle and use this compound with proper safety precautions.
Uses
Used in Pharmaceutical Industry:
N-acetyl-N-propylacetamide is used as an active ingredient for its anti-inflammatory and analgesic properties, helping to alleviate pain and reduce inflammation in various medicinal formulations.
Used in Cosmetic Industry:
In the cosmetic industry, N-acetyl-N-propylacetamide is utilized for its skin-soothing and anti-inflammatory effects, making it a beneficial component in skincare products.
Used as a Solvent in Organic Compound Production:
N-acetyl-N-propylacetamide is employed as a solvent in the synthesis and production of various organic compounds, facilitating chemical reactions and improving the overall efficiency of the process.
Check Digit Verification of cas no
The CAS Registry Mumber 1563-84-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,5,6 and 3 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1563-84:
(6*1)+(5*5)+(4*6)+(3*3)+(2*8)+(1*4)=84
84 % 10 = 4
So 1563-84-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H13NO2/c1-4-5-8(6(2)9)7(3)10/h4-5H2,1-3H3
