15958-27-7 Usage
Chemical compound
2-[(2-cyanoethyl)[p-[(p-nitrophenyl)azo]phenyl]amino]ethyl carbanilate This is the full name of the compound, which describes its structure and components.
Dye intermediate
The compound is commonly used in the textile industry for the production of azo dyes This indicates that the compound serves as a starting material or building block in the synthesis of azo dyes, which are a class of organic dyes used in various applications, including textiles.
Cyanoethyl and carbanilate groups
The compound contains both cyanoethyl and carbanilate groups These functional groups are responsible for the compound's suitability in the synthesis of a wide range of dyes, as they can react with other chemicals to form the desired dye structures.
Toxicity
The compound is toxic This property highlights the potential health risks associated with the compound, as it can cause harm to humans or the environment if not handled properly.
Check Digit Verification of cas no
The CAS Registry Mumber 15958-27-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,9,5 and 8 respectively; the second part has 2 digits, 2 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 15958-27:
(7*1)+(6*5)+(5*9)+(4*5)+(3*8)+(2*2)+(1*7)=137
137 % 10 = 7
So 15958-27-7 is a valid CAS Registry Number.
InChI:InChI=1/C24H22N6O4/c25-15-4-16-29(17-18-34-24(31)26-19-5-2-1-3-6-19)22-11-7-20(8-12-22)27-28-21-9-13-23(14-10-21)30(32)33/h1-3,5-14H,4,16-18H2,(H,26,31)/b28-27+