159903-67-0 Usage
Description
2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-indol-5-ol is a complex organic chemical compound characterized by its unique structure that features two indole rings connected by an ethylene bridge. 2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-in dol-5-ol also incorporates two aminoethyl groups and a bromine substituent on one of the indole rings, giving it a molecular formula of C26H28BrN5O and a molecular weight of 500.43 g/mol. It holds promise as a pharmaceutical intermediate, with potential applications in organic synthesis and medicinal chemistry due to its distinctive structural features and functional groups. Further research is essential to explore its full potential and properties.
Uses
Used in Pharmaceutical Industry:
2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-indol-5-ol is used as a pharmaceutical intermediate for its potential role in the development of new drugs. Its unique structure and functional groups may contribute to the creation of novel therapeutic agents, particularly in the fields of organic synthesis and medicinal chemistry.
Used in Organic Synthesis:
In the field of organic synthesis, 2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-indol-5-ol serves as a key compound that can be utilized in the synthesis of various organic molecules. Its presence of multiple reactive sites, such as the amino and bromine substituents, allows for a wide range of chemical reactions, making it a versatile building block for the creation of complex organic molecules.
Used in Medicinal Chemistry:
2,6-bis[2-amino-1-(6-bromo-1H-indol-3-yl)ethyl]-3-(2-aminoethyl)-1H-indol-5-ol is employed in medicinal chemistry for its potential to be incorporated into the design and synthesis of new pharmaceutical compounds. Its unique structural features and functional groups may enable the development of innovative drugs with improved efficacy and selectivity for various therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 159903-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,9,9,0 and 3 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 159903-67:
(8*1)+(7*5)+(6*9)+(5*9)+(4*0)+(3*3)+(2*6)+(1*7)=170
170 % 10 = 0
So 159903-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C30H30Br2N6O/c31-15-1-3-17-24(13-36-26(17)7-15)22(11-34)21-9-28-20(10-29(21)39)19(5-6-33)30(38-28)23(12-35)25-14-37-27-8-16(32)2-4-18(25)27/h1-4,7-10,13-14,22-23,36-39H,5-6,11-12,33-35H2