160455-70-9 Usage
General Description
2,4-bis(oxiran-2-ylmethyl)-5-propan-2-yl-1,2,4-triazol-3-one is a chemical compound with potential applications as an antifungal agent. It is a triazolone derivative that contains two oxirane groups and a propan-2-yl substituent. The compound has been studied for its ability to inhibit the growth of various fungal pathogens, making it a promising candidate for the development of new antifungal drugs. Its unique chemical structure and potential antifungal activity make it an interesting target for further research and development in the field of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 160455-70-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,0,4,5 and 5 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 160455-70:
(8*1)+(7*6)+(6*0)+(5*4)+(4*5)+(3*5)+(2*7)+(1*0)=119
119 % 10 = 9
So 160455-70-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H17N3O3/c1-7(2)10-12-14(4-9-6-17-9)11(15)13(10)3-8-5-16-8/h7-9H,3-6H2,1-2H3