162651-09-4 Usage
Description
2-Ethylamino-4-methyl-thiazole-5-carboxylic acid is a chemical compound characterized by the molecular formula C8H12N2O2S. It is a thiazole derivative that incorporates a carboxylic acid group, which endows it with unique chemical properties and reactivity. This versatile compound is known for its potential applications across various industries, particularly in pharmaceuticals and agriculture, where it serves as a valuable intermediate in drug synthesis and a building block for the creation of novel pesticides.
Uses
Used in Pharmaceutical Industry:
2-Ethylamino-4-methyl-thiazole-5-carboxylic acid is used as a chemical intermediate for the synthesis of certain drugs. Its structural features and functional groups facilitate its incorporation into complex molecular frameworks, contributing to the development of new therapeutic agents with specific pharmacological properties.
Used in Agricultural Industry:
In the agricultural sector, 2-Ethylamino-4-methyl-thiazole-5-carboxylic acid is utilized as a building block in the development of new pesticides. Its chemical versatility allows for the design of innovative compounds with targeted pest control capabilities, potentially leading to more effective and environmentally friendly agricultural solutions.
2-ETHYLAMINO-4-METHYL-THIAZOLE-5-CARBOXYLIC ACID's reactivity and structural attributes make it a promising candidate for further exploration in chemical research and development, with the potential to contribute to advancements in medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 162651-09-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,2,6,5 and 1 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 162651-09:
(8*1)+(7*6)+(6*2)+(5*6)+(4*5)+(3*1)+(2*0)+(1*9)=124
124 % 10 = 4
So 162651-09-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O2S/c1-3-8-7-9-4(2)5(12-7)6(10)11/h3H2,1-2H3,(H,8,9)(H,10,11)/p-1
