163260-73-9 Usage
General Description
4-(1,4-Dioxaspiro[4,5]dec-8-yl)-benzoic acid is a chemical compound with the molecular formula C15H16O4. It is a spiro compound, containing a spiro[4.5]decane ring system fused to a benzoic acid moiety. 4-(1,4-DIOXASPIRO[4,5]DEC-8-YL)-BENZOIC ACID is used in organic synthesis and pharmaceutical research as a building block for the synthesis of various biologically active molecules and drugs. It has potential applications in medicinal chemistry and drug development due to its unique structure and reactivity. Additionally, it may have biological activities that make it of interest for further investigation in the fields of pharmacology and biochemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 163260-73-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,3,2,6 and 0 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 163260-73:
(8*1)+(7*6)+(6*3)+(5*2)+(4*6)+(3*0)+(2*7)+(1*3)=119
119 % 10 = 9
So 163260-73-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H18O4/c16-14(17)13-3-1-11(2-4-13)12-5-7-15(8-6-12)18-9-10-19-15/h1-4,12H,5-10H2,(H,16,17)