16599-85-2 Usage
Chemical composition
Consists of a cationic pyridinium ring with a tetrafluoroborate anion.
Usage
Frequently used as a fluorescent dye in various biological and chemical applications, including microscopy, flow cytometry, and as a stain for nucleic acids and proteins.
Color
Red to pink.
Solubility
Water-soluble.
Photodynamic therapy potential
Can produce reactive oxygen species upon exposure to light, making it a potential therapeutic agent.
Importance
Significant chemical in the fields of biology and medicine due to its fluorescent properties and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 16599-85-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,5,9 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 16599-85:
(7*1)+(6*6)+(5*5)+(4*9)+(3*9)+(2*8)+(1*5)=152
152 % 10 = 2
So 16599-85-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H13N3O.BF4/c1-2-16-10-4-3-5-13(16)15-14-11-6-8-12(17)9-7-11;2-1(3,4)5/h3-10H,2H2,1H3;/q;-1/p+1