16784-24-0 Usage
Chemical Family
Thiadiazoleamines
Structure
Thiadiazole ring with an amine group at the 2-position and a propoxy group at the 5-position
Potential Applications
a. Pharmaceutical industry
b. Agricultural industry
c. Building block for synthesis of organic compounds
d. Intermediate in chemical compound production
Biological Activity
May exhibit biological activity (requires further research)
Research Status
Further research and testing needed to understand properties and potential uses
Functional Groups
a. Thiadiazole ring
b. Amine group (-NH2)
c. Propoxy group (-OCH2CH2CH3)
Molecular Weight
Approximately 131.19 g/mol (calculated from the chemical formula)
Solubility
Solubility properties are not provided, but typically depend on the functional groups and molecular structure
Stability
Stability information is not provided, but it may be influenced by the presence of the thiadiazole ring and amine group
Reactivity
Reactivity information is not provided, but it may be influenced by the presence of the thiadiazole ring, amine group, and propoxy group
Hazards
No specific hazards mentioned, but potential hazards should be considered based on the functional groups and molecular structure (requires further research)
Environmental Impact
No specific information provided, but potential environmental impact should be considered (requires further research)
Check Digit Verification of cas no
The CAS Registry Mumber 16784-24-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,6,7,8 and 4 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 16784-24:
(7*1)+(6*6)+(5*7)+(4*8)+(3*4)+(2*2)+(1*4)=130
130 % 10 = 0
So 16784-24-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3OS/c1-2-3-9-5-8-7-4(6)10-5/h2-3H2,1H3,(H2,6,7)