172516-34-6 Usage
General Description
ETHYL 3-[(2-ETHOXY-2-OXOETHYL)THIO]-4-OXO-4,5,6,7-TETRAHYDROBENZO[C]THIOPHENE-1-CARBOXYLATE is a chemical compound with a complex structure. It contains an ethyl ester group, a thioester group, and a tetrahydrobenzo[c]thiophene ring. ETHYL 3-[(2-ETHOXY-2-OXOETHYL)THIO]-4-OXO-4,5,6,7-TETRAHYDROBENZO[C]THIOPHENE-1-CARBOXYLATE may have applications in the pharmaceutical industry due to its potential biological activity. The presence of the ethyl and ethoxy groups suggests that it is a relatively small molecule with low molecular weight, which could make it suitable for various chemical and pharmaceutical applications. However, more research is needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 172516-34-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,5,1 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 172516-34:
(8*1)+(7*7)+(6*2)+(5*5)+(4*1)+(3*6)+(2*3)+(1*4)=126
126 % 10 = 6
So 172516-34-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H18O5S2/c1-3-19-11(17)8-21-15-12-9(6-5-7-10(12)16)13(22-15)14(18)20-4-2/h3-8H2,1-2H3
