172516-35-7 Usage
General Description
Ethyl 3-(benzylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is a synthetic chemical compound with a complex molecular structure. It belongs to the class of organic compounds known as esters and is commonly used in the pharmaceutical and chemical industries. This chemical has the potential to exhibit various biological activities and is often studied for its potential medicinal properties. Additionally, it possesses a unique cyclic structure that makes it a valuable building block for developing new compounds with specific properties. Ethyl 3-(benzylthio)-4-oxo-4,5,6,7-tetrahydrobenzo[c]thiophene-1-carboxylate is an important chemical in the field of drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 172516-35-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,5,1 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 172516-35:
(8*1)+(7*7)+(6*2)+(5*5)+(4*1)+(3*6)+(2*3)+(1*5)=127
127 % 10 = 7
So 172516-35-7 is a valid CAS Registry Number.
InChI:InChI=1/C18H18O3S2/c1-2-21-17(20)16-13-9-6-10-14(19)15(13)18(23-16)22-11-12-7-4-3-5-8-12/h3-5,7-8H,2,6,9-11H2,1H3