172516-37-9 Usage
General Description
ETHYL 4-(METHOXYIMINO)-3-(METHYLTHIO)-4,5,6,7-TETRAHYDROBENZO[C]THIOPHENE-1-CARBOXYLATE is a complex chemical compound with a molecular structure that includes a combination of ethyl, methoxyimino, methylthio, and benzo[c]thiophene groups. ETHYL 4-(METHOXYIMINO)-3-(METHYLTHIO)-4,5,6,7-TETRAHYDROBENZO[C]THIOPHENE-1-CARBOXYLATE is classified as an ester due to the presence of the carboxylate functional group. It is often used in various chemical and pharmaceutical applications as a building block for the synthesis of other organic compounds, particularly those with potential pharmacological properties.ETHYL 4-(METHOXYIMINO)-3-(METHYLTHIO)-4,5,6,7-TETRAHYDROBENZO[C]THIOPHENE-1-CARBOXYLATE is known for its diverse range of chemical and biological activities, making it a valuable component in the development of new drugs and chemical products.
Check Digit Verification of cas no
The CAS Registry Mumber 172516-37-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,5,1 and 6 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 172516-37:
(8*1)+(7*7)+(6*2)+(5*5)+(4*1)+(3*6)+(2*3)+(1*7)=129
129 % 10 = 9
So 172516-37-9 is a valid CAS Registry Number.
InChI:InChI=1/C13H17NO3S2/c1-4-17-12(15)11-8-6-5-7-9(14-16-2)10(8)13(18-3)19-11/h4-7H2,1-3H3/b14-9-