172798-64-0 Usage
General Description
(2S)-2-[[(2S)-2-[(4-butoxybenzoyl)amino]-3-phenyl-propanoyl]amino]-4-methylsulfanyl-butanoic acid, also known as Boc-phenylalanine, is a compound used in peptide synthesis. It is a derivative of phenylalanine, an essential amino acid that the body cannot produce on its own. Boc-phenylalanine is often utilized as a building block in the creation of peptides for various pharmaceutical and biochemical applications. Its chemical structure features a butoxybenzoyl group and a methylsulfanyl group, both of which contribute to its unique properties and potential biological activities. Overall, Boc-phenylalanine plays a crucial role in the development and synthesis of peptides with specific structures and functions.
Check Digit Verification of cas no
The CAS Registry Mumber 172798-64-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,2,7,9 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 172798-64:
(8*1)+(7*7)+(6*2)+(5*7)+(4*9)+(3*8)+(2*6)+(1*4)=180
180 % 10 = 0
So 172798-64-0 is a valid CAS Registry Number.
InChI:InChI=1/C25H32N2O5S/c1-3-4-15-32-20-12-10-19(11-13-20)23(28)27-22(17-18-8-6-5-7-9-18)24(29)26-21(25(30)31)14-16-33-2/h5-13,21-22H,3-4,14-17H2,1-2H3,(H,26,29)(H,27,28)(H,30,31)/t21-,22-/m0/s1