175135-56-5 Usage
General Description
3-Chloro-2,6-Dimethoxy-5-Nitrobenzoic Acid is a chemical compound involving several different elements with a specific arrangement. 3-CHLORO-2,6-DIMETHOXY-5-NITROBENZOIC ACID includes chlorine, which is often used in chemical reactions as an effective electron donor. The presence of two methoxy groups indicates the compound could serve as an efficient nucleophile, or electron pair donor, in chemical reactions. The nitro group adds nitrogen and oxygen to the mix, potentially making this compound useful in reactions requiring these elements. Lastly, the benzoic acid portion suggests that this compound may have acidic properties. Therefore, its potential uses could be versatile within the field of chemistry, possibly including acting as an intermediate in chemical synthesis, pharmacology, or materials science. However, further study would be needed to ascertain its specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 175135-56-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 175135-56:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*5)+(2*5)+(1*6)=135
135 % 10 = 5
So 175135-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H8ClNO6/c1-16-7-4(10)3-5(11(14)15)8(17-2)6(7)9(12)13/h3H,1-2H3,(H,12,13)/p-1
