175137-39-0 Usage
Description
3-Amino-2-cyano-5-(4-fluorophenyl)thiophene is a chemical compound that belongs to the class of organic compounds, specifically organosulfur compounds. It is composed of carbon, hydrogen, nitrogen, sulfur, and fluorine atoms arranged in a unique structure. 3-AMINO-2-CYANO-5-(4-FLUOROPHENYL)THIOPHENE is highly reactive and is particularly valuable in medicinal chemistry as a building block for the synthesis of more complex molecules. Due to its reactivity, it is essential to handle this chemical with caution to avoid potential hazards.
Uses
Used in Medicinal Chemistry:
3-Amino-2-cyano-5-(4-fluorophenyl)thiophene is used as a building block for the synthesis of complex compounds in medicinal chemistry. Its highly reactive nature allows it to be incorporated into various chemical structures, making it a valuable component in the development of new pharmaceuticals.
Used in Chemical Syntheses:
In the field of chemical synthesis, 3-Amino-2-cyano-5-(4-fluorophenyl)thiophene is used as a key intermediate. Its reactivity enables it to participate in a wide range of chemical reactions, contributing to the formation of diverse molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
3-Amino-2-cyano-5-(4-fluorophenyl)thiophene is used as a precursor in the pharmaceutical industry for the development of new drugs. Its unique structure and reactivity make it a promising candidate for the creation of novel therapeutic agents with potential applications in treating various diseases and medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 175137-39-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,1,3 and 7 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 175137-39:
(8*1)+(7*7)+(6*5)+(5*1)+(4*3)+(3*7)+(2*3)+(1*9)=140
140 % 10 = 0
So 175137-39-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7FS/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5H,1H3