175201-90-8 Usage
Description
4-(3-Aminophenyl)-2-methylpyrimidine is a chemical compound belonging to the class of pyrimidines and derivatives. It is an aromatic heterocyclic compound characterized by a six-membered ring with two nitrogen atoms at non-adjacent positions, along with an aminophenyl group and a methyl group attached to the pyrimidine ring. The unique structural makeup of this compound endows it with specific properties that can vary in terms of physical and chemical characteristics, such as solubility, melting and boiling points, and potential applications. Detailed information regarding these aspects is usually found in specialized chemical resources or safety data sheets.
Uses
Since the provided materials do not specify the uses of 4-(3-Aminophenyl)-2-methylpyrimidine, it is not possible to list its applications based on the given information. However, pyrimidines and their derivatives are generally known for their wide range of applications in various fields, such as pharmaceuticals, agrochemicals, and materials science. They can be used as building blocks for the synthesis of biologically active compounds, including drugs, pesticides, and dyes. Additionally, they may serve as intermediates in organic synthesis or as components in the development of new materials with specific properties.
To provide a more accurate and detailed description of the uses of 4-(3-Aminophenyl)-2-methylpyrimidine, further information and research would be required.
Check Digit Verification of cas no
The CAS Registry Mumber 175201-90-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,0 and 1 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 175201-90:
(8*1)+(7*7)+(6*5)+(5*2)+(4*0)+(3*1)+(2*9)+(1*0)=118
118 % 10 = 8
So 175201-90-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3/c1-8-13-6-5-11(14-8)9-3-2-4-10(12)7-9/h2-7H,12H2,1H3
