176200-91-2 Usage
Description
2-(2-CHLORO-ETHYL)-5-FLUORO-ISOINDOLE-1,3-DIONE is a heterocyclic compound characterized by a unique structure that includes a 2-chloro-ethyl group, a fluorine atom, and an isoindole-1,3-dione moiety. 2-(2-CHLORO-ETHYL)-5-FLUORO-ISOINDOLE-1,3-DIONE holds potential in various fields due to its intriguing chemical composition and possible biological activity.
Used in Pharmaceutical Industry:
2-(2-CHLORO-ETHYL)-5-FLUORO-ISOINDOLE-1,3-DIONE is used as a pharmaceutical compound for its potential biological activity. Its unique structure may contribute to the development of new drugs, offering novel therapeutic options.
Used in Agrochemical Industry:
In the agrochemical sector, 2-(2-CHLORO-ETHYL)-5-FLUORO-ISOINDOLE-1,3-DIONE is used as a precursor or active ingredient in the development of pesticides. Its chemical properties could be harnessed to create more effective and targeted agrochemicals.
Used in Materials Science:
2-(2-CHLORO-ETHYL)-5-FLUORO-ISOINDOLE-1,3-DIONE is utilized in materials science for the potential to develop new materials with enhanced properties. Its incorporation into existing materials could lead to improvements in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 176200-91-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,6,2,0 and 0 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 176200-91:
(8*1)+(7*7)+(6*6)+(5*2)+(4*0)+(3*0)+(2*9)+(1*1)=122
122 % 10 = 2
So 176200-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H7ClFNO2/c11-3-4-13-9(14)7-2-1-6(12)5-8(7)10(13)15/h1-2,5H,3-4H2
