179873-47-3 Usage
General Description
N-methyl-4-(1-methyl-1H-pyrazol-3-yl)benzylamine is a chemical compound with the molecular formula C15H18N2. It belongs to the class of organic compounds known as 1,2,4-triazole derivatives and is characterized by a 1-methyl-1H-pyrazole group attached to a benzylamine moiety. n-methyl-4-(1-methyl-1h-pyrazol-3-yl)benzylamine has various applications in pharmaceutical research, especially in the development of potential drug candidates due to its potential biological activities. It may also be used in chemical synthesis and as a reagent in organic chemistry. Additionally, N-methyl-4-(1-methyl-1H-pyrazol-3-yl)benzylamine has the potential to be used as a building block in the synthesis of more complex chemical compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 179873-47-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,9,8,7 and 3 respectively; the second part has 2 digits, 4 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 179873-47:
(8*1)+(7*7)+(6*9)+(5*8)+(4*7)+(3*3)+(2*4)+(1*7)=203
203 % 10 = 3
So 179873-47-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H15N3/c1-13-9-10-3-5-11(6-4-10)12-7-8-15(2)14-12/h3-8,13H,9H2,1-2H3