185423-02-3 Usage
General Description
2-Chloro-3-hydroxyisonicotinic acid is a chemical compound with the molecular formula C7H5ClNO3. It is a derivative of isonicotinic acid, containing a hydroxy and a chloro group. 2-CHLORO-3-HYDROXYISONICOTINIC ACID is commonly used in the synthesis of pharmaceuticals and agrochemicals due to its potential as a building block for bioactive molecules. It can also be used as a starting material for the synthesis of various heterocyclic compounds. Additionally, it has been studied for its potential therapeutic applications, including its antifungal and antibacterial properties. Overall, 2-Chloro-3-hydroxyisonicotinic acid is a versatile chemical with potential applications in various fields, including medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 185423-02-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,8,5,4,2 and 3 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 185423-02:
(8*1)+(7*8)+(6*5)+(5*4)+(4*2)+(3*3)+(2*0)+(1*2)=133
133 % 10 = 3
So 185423-02-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H4ClNO3/c7-5-4(9)3(6(10)11)1-2-8-5/h1-2,9H,(H,10,11)
