190273-81-5 Usage
General Description
2-Amino-5-fluoroquinazoline is a chemical compound with the molecular formula C8H6FN3. It is a fluorinated quinazoline derivative with potential applications in the pharmaceutical industry due to its unique properties. 2-Amino-5-fluoroquinazoline has been studied for its potential use in the development of new drugs with anti-cancer, anti-inflammatory, and anti-microbial properties. Its structure and reactivity make it suitable for use as a building block in the synthesis of various heterocyclic compounds and it has also shown promising results in biological assays, making it a potential candidate for further research and development in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 190273-81-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,0,2,7 and 3 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 190273-81:
(8*1)+(7*9)+(6*0)+(5*2)+(4*7)+(3*3)+(2*8)+(1*1)=135
135 % 10 = 5
So 190273-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6FN3/c9-6-2-1-3-7-5(6)4-11-8(10)12-7/h1-4H,(H2,10,11,12)
