19433-94-4 Usage
General Description
N-[3-[(2-Cyanoethyl)ethylamino]-4-methoxyphenyl]acetamide is a chemical compound with the molecular formula C15H20N2O2. The molecule is made up of multiple functional groups, namely an amine group (NH2), an acetamide group (CH3CONH2), a cyanide group (CN) and a methoxy group (OCH3), arranged around a phenyl ring. It is a derivative of phenylacetamide and also known as a bis(cyanoethyl)amine compound due to the presence of two cyanoethyl groups. It is generally known for its application in the chemical industry, although detailed specific uses and properties would depend on the supplier and their product specifications. The effects of exposure or ingestion to this chemical are not publicly well-documented, highlighting the importance of handling it with appropriate safety measures.
Check Digit Verification of cas no
The CAS Registry Mumber 19433-94-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,4,3 and 3 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19433-94:
(7*1)+(6*9)+(5*4)+(4*3)+(3*3)+(2*9)+(1*4)=124
124 % 10 = 4
So 19433-94-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H19N3O2/c1-4-17(9-5-8-15)13-10-12(16-11(2)18)6-7-14(13)19-3/h6-7,10H,4-5,9H2,1-3H3,(H,16,18)