194658-14-5 Usage
General Description
2-Pyridinemethanamine,4-methoxy-(9CI) is a chemical compound belonging to the class of organic compounds known as phenylpyridines, classified as aromatic heteropolycyclic compounds. Its molecular formula is C8H10N2O and has a molar mass of around 150.18 g/mol. This chemical is involved in many organic syntheses and chemical reactions, useful for the production of pharmaceuticals, dyes, or other useful organic compounds. Its specific properties, such as physical state, color, or melting and boiling points, can vary depending on the specific conditions, such as temperature and pressure. Like many chemicals, it should be handled with appropriate safety measures to prevent any potential risks or harm.
Check Digit Verification of cas no
The CAS Registry Mumber 194658-14-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,9,4,6,5 and 8 respectively; the second part has 2 digits, 1 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 194658-14:
(8*1)+(7*9)+(6*4)+(5*6)+(4*5)+(3*8)+(2*1)+(1*4)=175
175 % 10 = 5
So 194658-14-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O/c1-10-7-2-3-9-6(4-7)5-8/h2-4H,5,8H2,1H3