1960-60-7 Usage
General Description
2-amino-3-bromo-7-fluoro-9H-fluoren-9-ol is a chemical compound with the molecular formula C13H8BrFNO. It is a fluorescent organic compound that contains amino, bromine, and fluorine functional groups. 2-amino-3-bromo-7-fluoro-9H-fluoren-9-ol is commonly used in the field of organic chemistry and materials science for its unique properties and versatility. It is also used as a building block in the synthesis of various pharmaceuticals, dyes, and polymers. 2-amino-3-bromo-7-fluoro-9H-fluoren-9-ol is known for its high stability and resistance to degradation, making it an important compound in the development of advanced materials and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 1960-60-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,9,6 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1960-60:
(6*1)+(5*9)+(4*6)+(3*0)+(2*6)+(1*0)=87
87 % 10 = 7
So 1960-60-7 is a valid CAS Registry Number.
InChI:InChI=1/C13H9BrFNO/c14-11-4-8-7-2-1-6(15)3-9(7)13(17)10(8)5-12(11)16/h1-5,13,17H,16H2
