197-74-0 Usage
General Description
2,3:8,9-Di[1,3]butadienoperylene is a chemical compound commonly used in organic electronic devices and as a pigment in inks and coatings. It is a polycyclic aromatic hydrocarbon (PAH) with a distinctive structure that includes two side-by-side butadiene chains attached to a perylene core. 2,3:8,9-Di[1,3]butadienoperylene has unique optical and electronic properties, making it useful in the development of organic semiconductors and in the field of optoelectronics. Its extended conjugated system allows for efficient charge transport, making it a valuable component in the production of organic light-emitting diodes (OLEDs) and organic photovoltaic cells. However, like other PAHs, 2,3:8,9-Di[1,3]butadienoperylene is also considered to be a potential environmental and health hazard due to its persistence and potential toxicity. Therefore, its use and disposal should be carefully managed to prevent negative impacts on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 197-74-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 1,9 and 7 respectively; the second part has 2 digits, 7 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 197-74:
(5*1)+(4*9)+(3*7)+(2*7)+(1*4)=80
80 % 10 = 0
So 197-74-0 is a valid CAS Registry Number.
InChI:InChI=1/C28H16/c1-3-9-19-17(7-1)15-25-23-13-6-12-22-20-10-4-2-8-18(20)16-26(28(22)23)24-14-5-11-21(19)27(24)25/h1-16H