19709-85-4 Usage
General Description
ETHYLENEDIAMINETETRAACETIC ACID DICALCIUM SALT is a chemical compound commonly used as a chelating agent and metal ion chelator. It has the ability to bind metal ions, such as calcium, zinc, and copper, and is often used in various industrial and laboratory applications, including in the manufacture of pharmaceuticals, detergents, and as a water treatment additive. ETHYLENEDIAMINETETRAACETIC ACID DICALCIUM SALT is also utilized in the food and beverage industry as a stabilizer and preservative. Additionally, it has potential applications in agriculture as a soil conditioner and nutrient chelator. ETHYLENEDIAMINETETRAACETIC ACID DICALCIUM SALT is known for its strong chelating properties and its ability to effectively sequester metal ions, making it a versatile and widely used chemical in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 19709-85-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,0 and 9 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19709-85:
(7*1)+(6*9)+(5*7)+(4*0)+(3*9)+(2*8)+(1*5)=144
144 % 10 = 4
So 19709-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H16N2O8.2Ca/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+2/p-4
