19721-24-5 Usage
General Description
1,4,5-triamino-2,3-dichloro-8-hydroxyanthraquinone is a chemical compound with a complex structure containing multiple functional groups. It is a hydroxyanthraquinone derivative, which means it has a backbone of anthraquinone with an attached hydroxy group. Additionally, it contains two chlorine atoms and three amino groups, which gives it strong potential for interactions with other molecules. The compound has potential applications in the field of dye and pigment chemistry due to its aromatic structure and ability to form complex structures with metal ions. Its specific properties and reactivity make it a subject of interest for researchers and scientists in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 19721-24-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,7,2 and 1 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 19721-24:
(7*1)+(6*9)+(5*7)+(4*2)+(3*1)+(2*2)+(1*4)=115
115 % 10 = 5
So 19721-24-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H9Cl2N3O3/c15-9-10(16)12(19)8-7(11(9)18)13(21)5-3(17)1-2-4(20)6(5)14(8)22/h1-2,20H,17-19H2
