19881-53-9 Usage
General Description
Ethyl 3-phenyl-DL-alaninate hydrochloride is a chemical compound with various potential applications in the field of science. It is often used in biochemical and pharmaceutical research due to its capacity to react in certain biological systems. The ethyl ester group (ethyl 3-phenyl-) is responsible for its potential as a prodrug, while the alaninate part may participate in peptide formation. Its hydrochloride form enhances solubility and hence suitability for biological studies. It's necessary to handle and store this chemical properly, as it may pose hazards such as skin and eye irritation. Its exact physical and chemical properties depend on its purity and storage conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 19881-53-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,8,8 and 1 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 19881-53:
(7*1)+(6*9)+(5*8)+(4*8)+(3*1)+(2*5)+(1*3)=149
149 % 10 = 9
So 19881-53-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO2.ClH/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;/h3-7,10H,2,8,12H2,1H3;1H/t10-;/m0./s1
