19976-95-5 Usage
Molecular structure
The compound contains a piperazine ring, a benzyl moiety, an ethanol group, and a xanthine derivative.
Xanthine derivative
The compound is described as a xanthine derivative with a benzyl group attached to the nitrogen atom.
Biological activity
The presence of a piperazine ring suggests that the compound may have biological activity, as piperazine derivatives are known for their pharmacological properties.
Specific properties and uses
The specific properties and potential uses of this compound would need to be further investigated through experimental studies.
Check Digit Verification of cas no
The CAS Registry Mumber 19976-95-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,7 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19976-95:
(7*1)+(6*9)+(5*9)+(4*7)+(3*6)+(2*9)+(1*5)=175
175 % 10 = 5
So 19976-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C24H34N6O3/c1-17(2)19-7-5-18(6-8-19)13-28-9-11-29(12-10-28)14-20(31)15-30-16-25-22-21(30)23(32)27(4)24(33)26(22)3/h5-8,16-17,20,31H,9-15H2,1-4H3