19997-52-5 Usage
General Description
2-(bromomethyl)-2,3-dihydro-5-methoxybenzofuran is a chemical compound that is a derivative of benzofuran, which is a heterocyclic compound commonly found in natural products and pharmaceuticals. The "2-(bromomethyl)" group indicates the presence of a bromine atom attached to a methyl group, while the "2,3-dihydro-5-methoxy" group refers to the specific configuration and substitutions on the benzofuran ring. 2-(bromomethyl)-2,3-dihydro-5-methoxybenzofuran has potential applications in medicinal chemistry and drug development due to its unique structure and ability to interact with biological targets. However, its specific uses and properties would depend on further studies and research into its pharmacological and chemical characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 19997-52-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,9,9 and 7 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 19997-52:
(7*1)+(6*9)+(5*9)+(4*9)+(3*7)+(2*5)+(1*2)=175
175 % 10 = 5
So 19997-52-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11BrO2/c1-12-8-2-3-10-7(4-8)5-9(6-11)13-10/h2-4,9H,5-6H2,1H3
