39952-00-6 Usage
Appearance
Yellow-orange powder
The compound has a yellow-orange color and takes the form of a powder.
Potential applications
Chemistry and materials science
The compound may have possible uses in the fields of chemistry and materials science, although specific applications are still being researched.
Chemical structure
Benzene ring with a nitro group and a nitrile group
The compound contains a benzene ring, which is a six-membered aromatic ring, with a nitro group (-NO2) and a nitrile group (-CN) attached.
Additional functional groups
Diazo group and cyanoethylamino group
The presence of a diazo group (-N=N-) and a cyanoethylamino group (-NH-CH2-CH2-CN) contributes to the compound's unique properties.
Usage
Synthesis of other compounds or as a reagent in chemical reactions
The compound may be used in the synthesis of other compounds or as a reagent to facilitate chemical reactions.
Ongoing research
Precise uses and properties
The specific uses and properties of the compound are still being investigated and experimented upon by the scientific community.
Check Digit Verification of cas no
The CAS Registry Mumber 39952-00-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,9,5 and 2 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 39952-00:
(7*3)+(6*9)+(5*9)+(4*5)+(3*2)+(2*0)+(1*0)=146
146 % 10 = 6
So 39952-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C16H11ClN6O2/c17-14-9-12(2-4-16(14)20-7-1-6-18)21-22-15-5-3-13(23(24)25)8-11(15)10-19/h2-5,8-9,20H,1,7H2/b22-21+