49722-90-9 Usage
General Description
6-Amino-2-hydroxypurine, also known as 2-Amino-6-hydroxypurine or adenine, is a chemical compound that is a purine derivative and a vital component of nucleic acids such as DNA and RNA. It is a heterocyclic organic compound with the molecular formula C5H5N5O, and it consists of a purine ring system with an amino group at the 6-position and a hydroxyl group at the 2-position. Adenine plays a crucial role in the storage and transfer of genetic information in living organisms and is involved in various metabolic processes. Additionally, it is commonly found in certain foods and beverages and has potential applications in pharmaceuticals and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 49722-90-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,7,2 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 49722-90:
(7*4)+(6*9)+(5*7)+(4*2)+(3*2)+(2*9)+(1*0)=149
149 % 10 = 9
So 49722-90-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5O.H2O4S/c6-3-2-4(8-1-7-2)10-5(11)9-3;1-5(2,3)4/h1H,(H4,6,7,8,9,10,11);(H2,1,2,3,4)
