49722-97-6 Usage
Chemical structure
1,7-dihydro-2H-adenine-2-thione sulphate is a chemical compound consisting of a 1,7-dihydro-2H-adenine-2-thione molecule bound to a sulphate group.
Derivative of adenine
It is a derivative of adenine, a nucleobase that is found in DNA and RNA.
Thione group
The thione group in the molecule is a sulfur analog of the ketone functional group.
Biological and pharmaceutical applications
1,7-dihydro-2H-adenine-2-thione sulphate has been studied for its potential biological and pharmaceutical applications.
Antiviral agent
It has been investigated for its possible role as an antiviral agent.
Research interest
Its structure and properties make it a subject of interest for researchers in the fields of organic chemistry and pharmaceutical science.
Molecular weight
The molecular weight of 1,7-dihydro-2H-adenine-2-thione sulphate is approximately 233.21 g/mol.
Solubility
The solubility of 1,7-dihydro-2H-adenine-2-thione sulphate may vary depending on the solvent used, but it is generally soluble in polar solvents like water.
Stability
The stability of 1,7-dihydro-2H-adenine-2-thione sulphate can be influenced by factors such as temperature, pH, and the presence of other chemical species.
Synthesis
The synthesis of 1,7-dihydro-2H-adenine-2-thione sulphate typically involves the reaction of a suitable precursor molecule with a sulphating agent.
Analytical techniques
Techniques such as nuclear magnetic resonance (NMR), mass spectrometry (MS), and infrared (IR) spectroscopy can be used to analyze and confirm the structure of 1,7-dihydro-2H-adenine-2-thione sulphate.
Reactivity
The reactivity of 1,7-dihydro-2H-adenine-2-thione sulphate may be influenced by the presence of the thione group and the sulphate group, which can participate in various chemical reactions.
Purity
The purity of 1,7-dihydro-2H-adenine-2-thione sulphate can be determined using techniques such as high-performance liquid chromatography (HPLC) or thin-layer chromatography (TLC).
Storage
1,7-dihydro-2H-adenine-2-thione sulphate should be stored in a cool, dry place, away from light and moisture, to maintain its stability and prevent degradation.
Check Digit Verification of cas no
The CAS Registry Mumber 49722-97-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,7,2 and 2 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 49722-97:
(7*4)+(6*9)+(5*7)+(4*2)+(3*2)+(2*9)+(1*7)=156
156 % 10 = 6
So 49722-97-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H5N5S.H2O4S/c6-3-2-4(8-1-7-2)10-5(11)9-3;1-5(2,3)4/h1H,(H4,6,7,8,9,10,11);(H2,1,2,3,4)
