79928-22-6 Usage
Classification
Imidazole derivative
Structure
Contains a 1H-Imidazole ring with a 2-(2,6-DIMETHYL-PHENYL)-ETHYL group attached
Potential applications
Medicinal and pharmaceutical chemistry
Additional research needed to determine specific properties and uses
Check Digit Verification of cas no
The CAS Registry Mumber 79928-22-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 7,9,9,2 and 8 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 79928-22:
(7*7)+(6*9)+(5*9)+(4*2)+(3*8)+(2*2)+(1*2)=186
186 % 10 = 6
So 79928-22-6 is a valid CAS Registry Number.
InChI:InChI=1/C13H16N2/c1-10-4-3-5-11(2)13(10)7-6-12-8-14-9-15-12/h3-5,8-9H,6-7H2,1-2H3,(H,14,15)