10-13-9 Usage
Description
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is a complex organic compound characterized by a benzene ring with two methoxy groups and two hydroxy groups positioned at the 1, 3, and 2 positions, respectively. It also features an ethenyl group attached to the 2 position of the benzene ring, which is denoted by the (E)prefix indicating its specific geometric isomerism. 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is commonly found in natural substances such as plants or fruits and may have potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis. Its structural complexity and the presence of multiple functional groups make it an interesting subject for further study and potential applications.
Uses
Used in Pharmaceutical Applications:
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used as a pharmaceutical compound for its potential therapeutic properties. The presence of multiple hydroxy and methoxy groups may contribute to its bioactivity, making it a candidate for the development of new drugs or as a modifier of existing pharmaceutical agents.
Used in Organic Synthesis:
In the field of organic synthesis, 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used as a chemical intermediate. Its complex structure and functional groups can be utilized in the synthesis of more complex organic molecules, potentially leading to the creation of novel compounds with specific applications.
Used in Chemical Research:
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used in chemical research as a subject of study for its unique structural features and potential reactivity. Researchers may investigate its properties, such as its stability, solubility, and reactivity with other compounds, to gain insights into its potential applications and to develop new synthetic routes or methods.
Used in the Food Industry:
Although not explicitly mentioned in the provided materials, given its natural occurrence in plants or fruits, 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol could potentially be used in the food industry as a natural additive or flavoring agent, taking advantage of its presence in certain food sources and its complex chemical structure.
Check Digit Verification of cas no
The CAS Registry Mumber 10-13-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 1 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10-13:
(4*1)+(3*0)+(2*1)+(1*3)=9
9 % 10 = 9
So 10-13-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O5/c1-20-15-13(18)5-4-10(14(15)19)3-2-9-6-11(16)8-12(17)7-9/h2-8,16-19H,1H3/b3-2+