10-13-9 Usage
Uses
Used in Pharmaceutical Applications:
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used as a pharmaceutical compound for its potential therapeutic properties. The presence of multiple hydroxy and methoxy groups may contribute to its bioactivity, making it a candidate for the development of new drugs or as a modifier of existing pharmaceutical agents.
Used in Organic Synthesis:
In the field of organic synthesis, 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used as a chemical intermediate. Its complex structure and functional groups can be utilized in the synthesis of more complex organic molecules, potentially leading to the creation of novel compounds with specific applications.
Used in Chemical Research:
4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol is used in chemical research as a subject of study for its unique structural features and potential reactivity. Researchers may investigate its properties, such as its stability, solubility, and reactivity with other compounds, to gain insights into its potential applications and to develop new synthetic routes or methods.
Used in the Food Industry:
Although not explicitly mentioned in the provided materials, given its natural occurrence in plants or fruits, 4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxy-benzene-1,3-diol could potentially be used in the food industry as a natural additive or flavoring agent, taking advantage of its presence in certain food sources and its complex chemical structure.
Check Digit Verification of cas no
The CAS Registry Mumber 10-13-9 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 1 and 0 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 10-13:
(4*1)+(3*0)+(2*1)+(1*3)=9
9 % 10 = 9
So 10-13-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H14O5/c1-20-15-13(18)5-4-10(14(15)19)3-2-9-6-11(16)8-12(17)7-9/h2-8,16-19H,1H3/b3-2+
