10-18-4 Usage
Uses
Used in Organic Chemistry:
6-ethenyl-3,6-dihydrodithiine 1-oxide is used as a precursor in the synthesis of various organic molecules due to its reactive nature and unique structure. Its sulfur content and ethenyl group provide versatility in chemical reactions, making it a valuable building block for the creation of new compounds.
Used in Pharmaceutical Chemistry:
6-ethenyl-3,6-dihydrodithiine 1-oxide has potential applications in pharmaceutical chemistry, where its unique structure and reactivity can be harnessed to develop new drugs or improve existing ones. Its sulfur-containing nature may offer advantages in drug design, such as enhancing the compound's ability to interact with biological targets or improving its pharmacokinetic properties.
Used in Research and Development:
6-ethenyl-3,6-dihydrodithiine 1-oxide is used as a subject of research and development in both academic and industrial settings. Its unique structure and reactivity make it an interesting compound for exploring new chemical reactions, understanding its properties, and discovering potential applications in various fields, including materials science, environmental chemistry, and more.
Check Digit Verification of cas no
The CAS Registry Mumber 10-18-4 includes 5 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 2 digits, 1 and 0 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 10-18:
(4*1)+(3*0)+(2*1)+(1*8)=14
14 % 10 = 4
So 10-18-4 is a valid CAS Registry Number.
InChI:InChI=1/C6H8OS2/c1-2-6-4-3-5-8-9(6)7/h2-4,6H,1,5H2
